Statistics
Total Visits
| Views | |
|---|---|
| Crystal structure of bis(acetylacetonato)-bis(3-methylpyridine)-nickel(II) dihydrate, Ni(C6H7N)(2)(C5H7O2)(2)center dot 2H(2)O | 94 |
Total Visits per Month
| April 2024 | May 2024 | June 2024 | July 2024 | August 2024 | September 2024 | October 2024 | |
|---|---|---|---|---|---|---|---|
| Crystal structure of bis(acetylacetonato)-bis(3-methylpyridine)-nickel(II) dihydrate, Ni(C6H7N)(2)(C5H7O2)(2)center dot 2H(2)O | 0 | 0 | 3 | 5 | 1 | 2 | 0 |
File Downloads
| Views |
|---|
Top Country Views
| Views | |
|---|---|
| United States | 42 |
| Germany | 22 |
| China | 13 |
| Sweden | 6 |
| Russia | 5 |
| Australia | 4 |
| Ukraine | 2 |
Top City Views
| Views | |
|---|---|
| Ashburn | 17 |
| Fairfield | 10 |
| Stockholm | 6 |
| Cambridge | 5 |
| Ann Arbor | 3 |
| Nanchang | 2 |
| Nanjing | 2 |
| Changshu | 1 |
| Dearborn | 1 |
| Dickson | 1 |