Statistics
Total Visits
| Views | |
|---|---|
| Crystal structure of bis(acetylacetonato)-bis(3-methylpyridine)-nickel(II) dihydrate, Ni(C6H7N)(2)(C5H7O2)(2)center dot 2H(2)O | 148 |
Total Visits per Month
| January 2025 | February 2025 | March 2025 | April 2025 | May 2025 | June 2025 | July 2025 | |
|---|---|---|---|---|---|---|---|
| Crystal structure of bis(acetylacetonato)-bis(3-methylpyridine)-nickel(II) dihydrate, Ni(C6H7N)(2)(C5H7O2)(2)center dot 2H(2)O | 2 | 6 | 2 | 2 | 10 | 11 | 3 |
File Downloads
| Views |
|---|
Top Country Views
| Views | |
|---|---|
| United States | 56 |
| Germany | 23 |
| China | 19 |
| Brazil | 10 |
| Australia | 8 |
| United Kingdom | 7 |
| Russia | 7 |
| Sweden | 6 |
| Venezuela | 4 |
| India | 2 |
Top City Views
| Views | |
|---|---|
| Ashburn | 18 |
| Fairfield | 10 |
| Stockholm | 6 |
| Cambridge | 5 |
| Ann Arbor | 4 |
| Caracas | 4 |
| San Francisco | 4 |
| Shanghai | 3 |
| Nanchang | 2 |
| Nanjing | 2 |